![]() | |
Identifiers | |
---|---|
3D model (JSmol)
|
|
ChEBI | |
ChEMBL | |
ChemSpider | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C10H13NO3 | |
Molar mass | 195.218 g·mol−1 |
Appearance | Colorless solid |
Hazards | |
GHS labelling:[1] | |
![]() | |
Warning | |
H315, H319, H335 | |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
N-Acetyldopamine is the organic compound with the formula CH3C(O)NHCH2CH2C6H3(OH)2. It is the N-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to redox and crosslinking.[2][3]
References
- ^ "N-Acetyldopamine". pubchem.ncbi.nlm.nih.gov. Retrieved 26 February 2022.
- ^ Andersen, Svend Olav (2010). "Insect cuticular sclerotization: A review". Insect Biochemistry and Molecular Biology. 40 (3): 166–178. doi:10.1016/j.ibmb.2009.10.007. PMID 19932179.
- ^ Kramer, Karl J.; Kanost, Michael R.; Hopkins, Theodore L.; Jiang, Haobo; Zhu, Yu Cheng; Xu, Rongda; Kerwin, J.L; Turecek, F. (2001). "Oxidative conjugation of catechols with proteins in insect skeletal systems". Tetrahedron. 57 (2): 385–392. doi:10.1016/S0040-4020(00)00949-2.
![](/s/i/modif.png)